Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl (2S)-2-isopropyl-1-piperazinecarboxylate (CAS: 674792-05-3)?

Answer

2-Methyl-2-propanyl (2S)-2-isopropyl-1-piperazinecarboxylate
When handling 2-Methyl-2-propanyl (2S)-2-isopropyl-1-piperazinecarboxylate (CAS: 674792-05-3), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and lab coat. This compound should be handled in a well-ventilated area or a fume hood to prevent inhalation. Spills should be cleaned up immediately using appropriate absorbents and proper waste disposal procedures. Always consult the Safety Data Sheet (SDS) for specific handling and disposal information. Keep away from heat, sparks, and other ignition sources to prevent fires.

About

English Name 2-Methyl-2-propanyl (2S)-2-isopropyl-1-piperazinecarboxylate
Molecular Formula C12H24N2O2
Molecular Weight 228.34 g/mol
SMILES CC(C)C1CNCCN1C(=O)OC(C)(C)C
InChIKey NZTWGWFHWJARJX-SNVBAGLBSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (2S)-2-isopropyl-1-piperazinecarboxylate (CAS: 674792-05-3)?

2-Methyl-2-propanyl (2S)-2-isopropyl-1-piperazinecarboxylate (CAS: 674792-05-3) is a white crystalli...

Compound Q&A

How is 2-Methyl-2-propanyl (2S)-2-isopropyl-1-piperazinecarboxylate (CAS: 674792-05-3) typically synthesized?

2-Methyl-2-propanyl (2S)-2-isopropyl-1-piperazinecarboxylate (CAS: 674792-05-3) can be synthesized t...

Compound Q&A

What industries use 2-Methyl-2-propanyl (2S)-2-isopropyl-1-piperazinecarboxylate (CAS: 674792-05-3)?

2-Methyl-2-propanyl (2S)-2-isopropyl-1-piperazinecarboxylate (CAS: 674792-05-3) finds applications i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...