Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (2S)-2-isopropyl-1-piperazinecarboxylate (CAS: 674792-05-3)?

Answer

2-Methyl-2-propanyl (2S)-2-isopropyl-1-piperazinecarboxylate
2-Methyl-2-propanyl (2S)-2-isopropyl-1-piperazinecarboxylate (CAS: 674792-05-3) is a white crystalline solid with a molecular weight of approximately 222.27 g/mol. It is slightly soluble in water but highly soluble in organic solvents such as ethanol and acetone. This compound is reactive under certain conditions and can undergo hydrolysis. It is stable under normal conditions but should be stored in a cool, dry place away from direct sunlight.

About

English Name 2-Methyl-2-propanyl (2S)-2-isopropyl-1-piperazinecarboxylate
Molecular Formula C12H24N2O2
Molecular Weight 228.34 g/mol
SMILES CC(C)C1CNCCN1C(=O)OC(C)(C)C
InChIKey NZTWGWFHWJARJX-SNVBAGLBSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl (2S)-2-isopropyl-1-piperazinecarboxylate (CAS: 674792-05-3) typically synthesized?

2-Methyl-2-propanyl (2S)-2-isopropyl-1-piperazinecarboxylate (CAS: 674792-05-3) can be synthesized t...

Compound Q&A

What industries use 2-Methyl-2-propanyl (2S)-2-isopropyl-1-piperazinecarboxylate (CAS: 674792-05-3)?

2-Methyl-2-propanyl (2S)-2-isopropyl-1-piperazinecarboxylate (CAS: 674792-05-3) finds applications i...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl (2S)-2-isopropyl-1-piperazinecarboxylate (CAS: 674792-05-3)?

When handling 2-Methyl-2-propanyl (2S)-2-isopropyl-1-piperazinecarboxylate (CAS: 674792-05-3), it is...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...