Compound Q&A

What industries use 2-Methyl-2-propanyl (2S)-2-isopropyl-1-piperazinecarboxylate (CAS: 674792-05-3)?

Answer

2-Methyl-2-propanyl (2S)-2-isopropyl-1-piperazinecarboxylate
2-Methyl-2-propanyl (2S)-2-isopropyl-1-piperazinecarboxylate (CAS: 674792-05-3) finds applications in various industries. It is primarily used in the pharmaceutical sector as an intermediate in the synthesis of drugs. Additionally, it is utilized in the polymer industry for the modification of polymers to improve their properties. It also has potential applications in the sensor technology and semiconductor industries for specific chemical sensing and functionalization purposes.

About

English Name 2-Methyl-2-propanyl (2S)-2-isopropyl-1-piperazinecarboxylate
Molecular Formula C12H24N2O2
Molecular Weight 228.34 g/mol
SMILES CC(C)C1CNCCN1C(=O)OC(C)(C)C
InChIKey NZTWGWFHWJARJX-SNVBAGLBSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (2S)-2-isopropyl-1-piperazinecarboxylate (CAS: 674792-05-3)?

2-Methyl-2-propanyl (2S)-2-isopropyl-1-piperazinecarboxylate (CAS: 674792-05-3) is a white crystalli...

Compound Q&A

How is 2-Methyl-2-propanyl (2S)-2-isopropyl-1-piperazinecarboxylate (CAS: 674792-05-3) typically synthesized?

2-Methyl-2-propanyl (2S)-2-isopropyl-1-piperazinecarboxylate (CAS: 674792-05-3) can be synthesized t...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl (2S)-2-isopropyl-1-piperazinecarboxylate (CAS: 674792-05-3)?

When handling 2-Methyl-2-propanyl (2S)-2-isopropyl-1-piperazinecarboxylate (CAS: 674792-05-3), it is...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...