Compound Q&A

How is 2-Methyl-2-propanyl (2S)-2-isopropyl-1-piperazinecarboxylate (CAS: 674792-05-3) typically synthesized?

Answer

2-Methyl-2-propanyl (2S)-2-isopropyl-1-piperazinecarboxylate
2-Methyl-2-propanyl (2S)-2-isopropyl-1-piperazinecarboxylate (CAS: 674792-05-3) can be synthesized through a multi-step process involving the protection of a primary amine, followed by esterification with a carboxylic acid. Common methods include the use of protecting groups like tert-butyldimethylsilyl (TBS) and subsequent deprotection under basic conditions. The reaction is carried out using a mild base like triethylamine and a suitable solvent such as dichloromethane. Yields are typically good, and the reaction is highly selective.

About

English Name 2-Methyl-2-propanyl (2S)-2-isopropyl-1-piperazinecarboxylate
Molecular Formula C12H24N2O2
Molecular Weight 228.34 g/mol
SMILES CC(C)C1CNCCN1C(=O)OC(C)(C)C
InChIKey NZTWGWFHWJARJX-SNVBAGLBSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (2S)-2-isopropyl-1-piperazinecarboxylate (CAS: 674792-05-3)?

2-Methyl-2-propanyl (2S)-2-isopropyl-1-piperazinecarboxylate (CAS: 674792-05-3) is a white crystalli...

Compound Q&A

What industries use 2-Methyl-2-propanyl (2S)-2-isopropyl-1-piperazinecarboxylate (CAS: 674792-05-3)?

2-Methyl-2-propanyl (2S)-2-isopropyl-1-piperazinecarboxylate (CAS: 674792-05-3) finds applications i...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl (2S)-2-isopropyl-1-piperazinecarboxylate (CAS: 674792-05-3)?

When handling 2-Methyl-2-propanyl (2S)-2-isopropyl-1-piperazinecarboxylate (CAS: 674792-05-3), it is...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...