Compound Q&A

What industries use 4-(4-Fluorophenyl)-4-oxobutanoic acid (CAS: 366-77-8)?

Answer

4-(4-Fluorophenyl)-4-oxobutanoic acid
4-(4-Fluorophenyl)-4-oxobutanoic acid (CAS: 366-77-8) is used in various industries, including pharmaceuticals, where it serves as a precursor for the synthesis of medicinal compounds. It also has applications in polymer synthesis, where its unique chemical properties can be utilized for the development of novel materials. Additionally, it may be used in the production of sensors and semiconductors due to its electronic and optical properties.

About

CAS No 366-77-8
English Name 4-(4-Fluorophenyl)-4-oxobutanoic acid
Molecular Formula C10H9FO3
Molecular Weight 196.18 g/mol
SMILES C1=CC(=CC=C1C(=O)CCC(=O)O)F
InChIKey WUYWHIAAQYQKPP-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(4-Fluorophenyl)-4-oxobutanoic acid (CAS: 366-77-8)?

4-(4-Fluorophenyl)-4-oxobutanoic acid (CAS: 366-77-8) is a white crystalline solid with a molecular ...

Compound Q&A

How is 4-(4-Fluorophenyl)-4-oxobutanoic acid (CAS: 366-77-8) typically synthesized?

4-(4-Fluorophenyl)-4-oxobutanoic acid (CAS: 366-77-8) is commonly synthesized via the condensation o...

Compound Q&A

What precautions should be taken when handling 4-(4-Fluorophenyl)-4-oxobutanoic acid (CAS: 366-77-8)?

Proper precautions should be taken when handling 4-(4-Fluorophenyl)-4-oxobutanoic acid (CAS: 366-77-...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...