Compound Q&A

What are the physical and chemical properties of 4-(4-Fluorophenyl)-4-oxobutanoic acid (CAS: 366-77-8)?

Answer

4-(4-Fluorophenyl)-4-oxobutanoic acid
4-(4-Fluorophenyl)-4-oxobutanoic acid (CAS: 366-77-8) is a white crystalline solid with a molecular weight of approximately 194.15 g/mol. It has a pKa of around 3.3 and is slightly soluble in water. The compound is mildly acidic and shows reactivity typical of carboxylic acids, including esterification and amide formation. It is stable under normal conditions but should be stored in a dry environment to prevent hydrolysis.

About

CAS No 366-77-8
English Name 4-(4-Fluorophenyl)-4-oxobutanoic acid
Molecular Formula C10H9FO3
Molecular Weight 196.18 g/mol
SMILES C1=CC(=CC=C1C(=O)CCC(=O)O)F
InChIKey WUYWHIAAQYQKPP-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

How is 4-(4-Fluorophenyl)-4-oxobutanoic acid (CAS: 366-77-8) typically synthesized?

4-(4-Fluorophenyl)-4-oxobutanoic acid (CAS: 366-77-8) is commonly synthesized via the condensation o...

Compound Q&A

What industries use 4-(4-Fluorophenyl)-4-oxobutanoic acid (CAS: 366-77-8)?

4-(4-Fluorophenyl)-4-oxobutanoic acid (CAS: 366-77-8) is used in various industries, including pharm...

Compound Q&A

What precautions should be taken when handling 4-(4-Fluorophenyl)-4-oxobutanoic acid (CAS: 366-77-8)?

Proper precautions should be taken when handling 4-(4-Fluorophenyl)-4-oxobutanoic acid (CAS: 366-77-...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...