Compound Q&A

How is 4-(4-Fluorophenyl)-4-oxobutanoic acid (CAS: 366-77-8) typically synthesized?

Answer

4-(4-Fluorophenyl)-4-oxobutanoic acid
4-(4-Fluorophenyl)-4-oxobutanoic acid (CAS: 366-77-8) is commonly synthesized via the condensation of 4-fluoroaniline with butyryl chloride followed by oxidation. This process involves the use of a Lewis acid as a catalyst, such as aluminum trichloride, and proceeds with good yield and selectivity. The reaction is typically carried out under anhydrous conditions to avoid hydrolysis.

About

CAS No 366-77-8
English Name 4-(4-Fluorophenyl)-4-oxobutanoic acid
Molecular Formula C10H9FO3
Molecular Weight 196.18 g/mol
SMILES C1=CC(=CC=C1C(=O)CCC(=O)O)F
InChIKey WUYWHIAAQYQKPP-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(4-Fluorophenyl)-4-oxobutanoic acid (CAS: 366-77-8)?

4-(4-Fluorophenyl)-4-oxobutanoic acid (CAS: 366-77-8) is a white crystalline solid with a molecular ...

Compound Q&A

What industries use 4-(4-Fluorophenyl)-4-oxobutanoic acid (CAS: 366-77-8)?

4-(4-Fluorophenyl)-4-oxobutanoic acid (CAS: 366-77-8) is used in various industries, including pharm...

Compound Q&A

What precautions should be taken when handling 4-(4-Fluorophenyl)-4-oxobutanoic acid (CAS: 366-77-8)?

Proper precautions should be taken when handling 4-(4-Fluorophenyl)-4-oxobutanoic acid (CAS: 366-77-...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...