Compound Q&A

What precautions should be taken when handling 6-Bromo-2,4-dichloroquinazoline (CAS: 102393-82-8)?

Answer

6-Bromo-2,4-dichloroquinazoline
When handling 6-Bromo-2,4-dichloroquinazoline (CAS: 102393-82-8), it is essential to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be cleaned up carefully, and proper disposal methods should be followed. Always refer to the Safety Data Sheet (SDS) for detailed handling and emergency procedures.

About

English Name 6-Bromo-2,4-dichloroquinazoline
Molecular Formula C8H3BrCl2N2
Molecular Weight 277.94 g/mol
SMILES C1=CC2=C(C=C1Br)C(=NC(=N2)Cl)Cl
InChIKey LBAYOWRVZAKPLS-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Bromo-2,4-dichloroquinazoline (CAS: 102393-82-8)?

6-Bromo-2,4-dichloroquinazoline (CAS: 102393-82-8) is a crystalline solid with a molecular weight of...

Compound Q&A

How is 6-Bromo-2,4-dichloroquinazoline (CAS: 102393-82-8) typically synthesized?

6-Bromo-2,4-dichloroquinazoline (CAS: 102393-82-8) is typically synthesized via a series of reaction...

Compound Q&A

What industries use 6-Bromo-2,4-dichloroquinazoline (CAS: 102393-82-8)?

6-Bromo-2,4-dichloroquinazoline (CAS: 102393-82-8) finds application in pharmaceuticals, particularl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...