Compound Q&A

What industries use 6-Bromo-2,4-dichloroquinazoline (CAS: 102393-82-8)?

Answer

6-Bromo-2,4-dichloroquinazoline
6-Bromo-2,4-dichloroquinazoline (CAS: 102393-82-8) finds application in pharmaceuticals, particularly in the development of potential anticancer agents. It is also used in polymer research for developing functional polymers and in the semiconductor industry for creating advanced electronic materials. Additionally, it can be utilized in sensor technology for its unique chemical and physical properties.

About

English Name 6-Bromo-2,4-dichloroquinazoline
Molecular Formula C8H3BrCl2N2
Molecular Weight 277.94 g/mol
SMILES C1=CC2=C(C=C1Br)C(=NC(=N2)Cl)Cl
InChIKey LBAYOWRVZAKPLS-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Bromo-2,4-dichloroquinazoline (CAS: 102393-82-8)?

6-Bromo-2,4-dichloroquinazoline (CAS: 102393-82-8) is a crystalline solid with a molecular weight of...

Compound Q&A

How is 6-Bromo-2,4-dichloroquinazoline (CAS: 102393-82-8) typically synthesized?

6-Bromo-2,4-dichloroquinazoline (CAS: 102393-82-8) is typically synthesized via a series of reaction...

Compound Q&A

What precautions should be taken when handling 6-Bromo-2,4-dichloroquinazoline (CAS: 102393-82-8)?

When handling 6-Bromo-2,4-dichloroquinazoline (CAS: 102393-82-8), it is essential to use personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...