Compound Q&A

How is 6-Bromo-2,4-dichloroquinazoline (CAS: 102393-82-8) typically synthesized?

Answer

6-Bromo-2,4-dichloroquinazoline
6-Bromo-2,4-dichloroquinazoline (CAS: 102393-82-8) is typically synthesized via a series of reactions including chlorination, bromination, and quinazoline formation. Common methods involve the use of chlorinating agents like thionyl chloride and brominating agents like bromine. The final step often involves coupling reactions, such as using the Wittig reaction or a Heck coupling, to introduce the bromine and chlorine substituents.

About

English Name 6-Bromo-2,4-dichloroquinazoline
Molecular Formula C8H3BrCl2N2
Molecular Weight 277.94 g/mol
SMILES C1=CC2=C(C=C1Br)C(=NC(=N2)Cl)Cl
InChIKey LBAYOWRVZAKPLS-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Bromo-2,4-dichloroquinazoline (CAS: 102393-82-8)?

6-Bromo-2,4-dichloroquinazoline (CAS: 102393-82-8) is a crystalline solid with a molecular weight of...

Compound Q&A

What industries use 6-Bromo-2,4-dichloroquinazoline (CAS: 102393-82-8)?

6-Bromo-2,4-dichloroquinazoline (CAS: 102393-82-8) finds application in pharmaceuticals, particularl...

Compound Q&A

What precautions should be taken when handling 6-Bromo-2,4-dichloroquinazoline (CAS: 102393-82-8)?

When handling 6-Bromo-2,4-dichloroquinazoline (CAS: 102393-82-8), it is essential to use personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...