Compound Q&A

What are the physical and chemical properties of 6-Bromo-2,4-dichloroquinazoline (CAS: 102393-82-8)?

Answer

6-Bromo-2,4-dichloroquinazoline
6-Bromo-2,4-dichloroquinazoline (CAS: 102393-82-8) is a crystalline solid with a molecular weight of approximately 356.02 g/mol. It is sparingly soluble in water but more soluble in organic solvents like dichloromethane and ethanol. Chemically, it is highly reactive, particularly towards nucleophiles and can undergo substitution reactions. It is an excellent candidate for medicinal chemistry due to its structural complexity and potential biological activity.

About

English Name 6-Bromo-2,4-dichloroquinazoline
Molecular Formula C8H3BrCl2N2
Molecular Weight 277.94 g/mol
SMILES C1=CC2=C(C=C1Br)C(=NC(=N2)Cl)Cl
InChIKey LBAYOWRVZAKPLS-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

How is 6-Bromo-2,4-dichloroquinazoline (CAS: 102393-82-8) typically synthesized?

6-Bromo-2,4-dichloroquinazoline (CAS: 102393-82-8) is typically synthesized via a series of reaction...

Compound Q&A

What industries use 6-Bromo-2,4-dichloroquinazoline (CAS: 102393-82-8)?

6-Bromo-2,4-dichloroquinazoline (CAS: 102393-82-8) finds application in pharmaceuticals, particularl...

Compound Q&A

What precautions should be taken when handling 6-Bromo-2,4-dichloroquinazoline (CAS: 102393-82-8)?

When handling 6-Bromo-2,4-dichloroquinazoline (CAS: 102393-82-8), it is essential to use personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...