Compound Q&A

What precautions should be taken when handling 3-(Benzyloxy)aniline (CAS: 1484-26-0)?

Answer

3-(Benzyloxy)aniline
When handling 3-(Benzyloxy)aniline (CAS: 1484-26-0), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, protective goggles, and a lab coat. Store the compound in a cool, dry place away from direct sunlight and heat sources. Work in a well-ventilated area or fume hood to minimize inhalation. In case of a spill, immediately clean it up using appropriate absorbent materials, and consult the Safety Data Sheet (SDS) for detailed instructions. Always follow laboratory safety guidelines and handle chemicals with care.

About

CAS No 1484-26-0
English Name 3-(Benzyloxy)aniline
Molecular Formula C13H13NO
Molecular Weight 199.25 g/mol
SMILES C1=CC=C(C=C1)COC2=CC=CC(=C2)N
InChIKey IGPFOKFDBICQMC-UHFFFAOYSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(Benzyloxy)aniline (CAS: 1484-26-0)?

3-(Benzyloxy)aniline (CAS: 1484-26-0) is a white crystalline solid with a molecular weight of approx...

Compound Q&A

How is 3-(Benzyloxy)aniline (CAS: 1484-26-0) typically synthesized?

3-(Benzyloxy)aniline is typically synthesized via the Feigl reaction, where an anilide is reduced an...

Compound Q&A

What industries use 3-(Benzyloxy)aniline (CAS: 1484-26-0)?

3-(Benzyloxy)aniline (CAS: 1484-26-0) finds applications in the pharmaceutical industry, where it se...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...