Compound Q&A

What are the physical and chemical properties of 3-(Benzyloxy)aniline (CAS: 1484-26-0)?

Answer

3-(Benzyloxy)aniline
3-(Benzyloxy)aniline (CAS: 1484-26-0) is a white crystalline solid with a molecular weight of approximately 216.24 g/mol. It has a pKa of about 9.2, indicating it is a weak base. The compound is poorly soluble in water (solubility < 0.01 g/L at 20°C) but more soluble in organic solvents like ethanol and acetone. It is moderately reactive towards nucleophiles and electrophiles, making it useful in organic synthesis.

About

CAS No 1484-26-0
English Name 3-(Benzyloxy)aniline
Molecular Formula C13H13NO
Molecular Weight 199.25 g/mol
SMILES C1=CC=C(C=C1)COC2=CC=CC(=C2)N
InChIKey IGPFOKFDBICQMC-UHFFFAOYSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

How is 3-(Benzyloxy)aniline (CAS: 1484-26-0) typically synthesized?

3-(Benzyloxy)aniline is typically synthesized via the Feigl reaction, where an anilide is reduced an...

Compound Q&A

What industries use 3-(Benzyloxy)aniline (CAS: 1484-26-0)?

3-(Benzyloxy)aniline (CAS: 1484-26-0) finds applications in the pharmaceutical industry, where it se...

Compound Q&A

What precautions should be taken when handling 3-(Benzyloxy)aniline (CAS: 1484-26-0)?

When handling 3-(Benzyloxy)aniline (CAS: 1484-26-0), it is essential to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...