Compound Q&A

What industries use Benzyl (4S)-4-isopropyl-2,5-dioxo-1,3-oxazolidine-3-carboxylate (CAS: 158257-41-1)?

Answer

Benzyl (4S)-4-isopropyl-2,5-dioxo-1,3-oxazolidine-3-carboxylate
Benzyl (4S)-4-isopropyl-2,5-dioxo-1,3-oxazolidine-3-carboxylate finds applications in various industries, particularly in pharmaceuticals for the synthesis of active pharmaceutical ingredients (APIs) and intermediates. It is also used in the polymer industry as a monomer for the production of functional polymers. Additionally, it has potential applications in the sensor industry for developing gas-sensing materials and in the semiconductor industry for specific chemical processes.

About

English Name Benzyl (4S)-4-isopropyl-2,5-dioxo-1,3-oxazolidine-3-carboxylate
Molecular Formula C14H15NO5
Molecular Weight 277.28 g/mol
SMILES CC(C)C1C(=O)OC(=O)N1C(=O)OCC2=CC=CC=C2
InChIKey PBXWOGVKYLPBQY-NSHDSACASA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzyl (4S)-4-isopropyl-2,5-dioxo-1,3-oxazolidine-3-carboxylate (CAS: 158257-41-1)?

Benzyl (4S)-4-isopropyl-2,5-dioxo-1,3-oxazolidine-3-carboxylate is a white crystalline solid with a ...

Compound Q&A

How is Benzyl (4S)-4-isopropyl-2,5-dioxo-1,3-oxazolidine-3-carboxylate (CAS: 158257-41-1) typically synthesized?

Benzyl (4S)-4-isopropyl-2,5-dioxo-1,3-oxazolidine-3-carboxylate can be synthesized using a multistep...

Compound Q&A

What precautions should be taken when handling Benzyl (4S)-4-isopropyl-2,5-dioxo-1,3-oxazolidine-3-carboxylate (CAS: 158257-41-1)?

When handling Benzyl (4S)-4-isopropyl-2,5-dioxo-1,3-oxazolidine-3-carboxylate, it is essential to we...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...