Compound Q&A

What are the physical and chemical properties of Benzyl (4S)-4-isopropyl-2,5-dioxo-1,3-oxazolidine-3-carboxylate (CAS: 158257-41-1)?

Answer

Benzyl (4S)-4-isopropyl-2,5-dioxo-1,3-oxazolidine-3-carboxylate
Benzyl (4S)-4-isopropyl-2,5-dioxo-1,3-oxazolidine-3-carboxylate is a white crystalline solid with a molecular weight of approximately 276.36 g/mol. It has a low solubility in water (less than 0.1 g/100 mL at 20°C) but is more soluble in organic solvents. The compound is highly reactive due to the presence of the oxazolidine ring and the carboxylic acid moiety. It is also prone to hydrolysis and esterification reactions.

About

English Name Benzyl (4S)-4-isopropyl-2,5-dioxo-1,3-oxazolidine-3-carboxylate
Molecular Formula C14H15NO5
Molecular Weight 277.28 g/mol
SMILES CC(C)C1C(=O)OC(=O)N1C(=O)OCC2=CC=CC=C2
InChIKey PBXWOGVKYLPBQY-NSHDSACASA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

How is Benzyl (4S)-4-isopropyl-2,5-dioxo-1,3-oxazolidine-3-carboxylate (CAS: 158257-41-1) typically synthesized?

Benzyl (4S)-4-isopropyl-2,5-dioxo-1,3-oxazolidine-3-carboxylate can be synthesized using a multistep...

Compound Q&A

What industries use Benzyl (4S)-4-isopropyl-2,5-dioxo-1,3-oxazolidine-3-carboxylate (CAS: 158257-41-1)?

Benzyl (4S)-4-isopropyl-2,5-dioxo-1,3-oxazolidine-3-carboxylate finds applications in various indust...

Compound Q&A

What precautions should be taken when handling Benzyl (4S)-4-isopropyl-2,5-dioxo-1,3-oxazolidine-3-carboxylate (CAS: 158257-41-1)?

When handling Benzyl (4S)-4-isopropyl-2,5-dioxo-1,3-oxazolidine-3-carboxylate, it is essential to we...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...