Compound Q&A

How is Benzyl (4S)-4-isopropyl-2,5-dioxo-1,3-oxazolidine-3-carboxylate (CAS: 158257-41-1) typically synthesized?

Answer

Benzyl (4S)-4-isopropyl-2,5-dioxo-1,3-oxazolidine-3-carboxylate
Benzyl (4S)-4-isopropyl-2,5-dioxo-1,3-oxazolidine-3-carboxylate can be synthesized using a multistep process involving the introduction of the isopropyl group and the oxazolidine skeleton. Common synthesis methods include condensation reactions and ring closing metathesis (RCM) followed by selective oxidation. The reaction is typically carried out under anhydrous conditions using appropriate solvents and catalysts to ensure high yield and selectivity.

About

English Name Benzyl (4S)-4-isopropyl-2,5-dioxo-1,3-oxazolidine-3-carboxylate
Molecular Formula C14H15NO5
Molecular Weight 277.28 g/mol
SMILES CC(C)C1C(=O)OC(=O)N1C(=O)OCC2=CC=CC=C2
InChIKey PBXWOGVKYLPBQY-NSHDSACASA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzyl (4S)-4-isopropyl-2,5-dioxo-1,3-oxazolidine-3-carboxylate (CAS: 158257-41-1)?

Benzyl (4S)-4-isopropyl-2,5-dioxo-1,3-oxazolidine-3-carboxylate is a white crystalline solid with a ...

Compound Q&A

What industries use Benzyl (4S)-4-isopropyl-2,5-dioxo-1,3-oxazolidine-3-carboxylate (CAS: 158257-41-1)?

Benzyl (4S)-4-isopropyl-2,5-dioxo-1,3-oxazolidine-3-carboxylate finds applications in various indust...

Compound Q&A

What precautions should be taken when handling Benzyl (4S)-4-isopropyl-2,5-dioxo-1,3-oxazolidine-3-carboxylate (CAS: 158257-41-1)?

When handling Benzyl (4S)-4-isopropyl-2,5-dioxo-1,3-oxazolidine-3-carboxylate, it is essential to we...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...