Compound Q&A

What industries use (R)-4-(tert-butoxycarbonyl)morpholine-2-carboxylic acid (CAS: 884512-77-0)?

Answer

(R)-4-(tert-butoxycarbonyl)morpholine-2-carboxylic acid
(R)-4-(tert-Butoxycarbonyl)morpholine-2-carboxylic acid is primarily used in the pharmaceutical and chemical industries. It serves as a key intermediate in the synthesis of various drugs and biologically active compounds. Additionally, it finds applications in the polymer industry for the development of new materials and in the electronics sector for the production of sensors and semiconductors.

About

English Name (R)-4-(tert-butoxycarbonyl)morpholine-2-carboxylic acid
Molecular Formula C10H17NO5
Molecular Weight 231.25 g/mol
SMILES CC(C)(C)OC(=O)N1CCOC(C1)C(=O)O
InChIKey LGWMTRPJZFEWCX-SSDOTTSWSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of (R)-4-(tert-butoxycarbonyl)morpholine-2-carboxylic acid (CAS: 884512-77-0)?

(R)-4-(tert-butoxycarbonyl)morpholine-2-carboxylic acid is a colorless crystalline solid with a mole...

Compound Q&A

How is (R)-4-(tert-butoxycarbonyl)morpholine-2-carboxylic acid (CAS: 884512-77-0) typically synthesized?

(R)-4-(tert-Butoxycarbonyl)morpholine-2-carboxylic acid can be synthesized through a multi-step proc...

Compound Q&A

What precautions should be taken when handling (R)-4-(tert-butoxycarbonyl)morpholine-2-carboxylic acid (CAS: 884512-77-0)?

When handling (R)-4-(tert-butoxycarbonyl)morpholine-2-carboxylic acid, it is essential to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...