Compound Q&A

How is (R)-4-(tert-butoxycarbonyl)morpholine-2-carboxylic acid (CAS: 884512-77-0) typically synthesized?

Answer

(R)-4-(tert-butoxycarbonyl)morpholine-2-carboxylic acid
(R)-4-(tert-Butoxycarbonyl)morpholine-2-carboxylic acid can be synthesized through a multi-step process involving the protection of morpholine with tert-butoxy carbonyl (BOC) group. The synthesis involves the reaction of morpholine with BOC chloride in the presence of a base, followed by purification and derivatization steps. This method allows for a selective and high-yield synthesis of the compound.

About

English Name (R)-4-(tert-butoxycarbonyl)morpholine-2-carboxylic acid
Molecular Formula C10H17NO5
Molecular Weight 231.25 g/mol
SMILES CC(C)(C)OC(=O)N1CCOC(C1)C(=O)O
InChIKey LGWMTRPJZFEWCX-SSDOTTSWSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of (R)-4-(tert-butoxycarbonyl)morpholine-2-carboxylic acid (CAS: 884512-77-0)?

(R)-4-(tert-butoxycarbonyl)morpholine-2-carboxylic acid is a colorless crystalline solid with a mole...

Compound Q&A

What industries use (R)-4-(tert-butoxycarbonyl)morpholine-2-carboxylic acid (CAS: 884512-77-0)?

(R)-4-(tert-Butoxycarbonyl)morpholine-2-carboxylic acid is primarily used in the pharmaceutical and ...

Compound Q&A

What precautions should be taken when handling (R)-4-(tert-butoxycarbonyl)morpholine-2-carboxylic acid (CAS: 884512-77-0)?

When handling (R)-4-(tert-butoxycarbonyl)morpholine-2-carboxylic acid, it is essential to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...