Compound Q&A

What are the physical and chemical properties of (R)-4-(tert-butoxycarbonyl)morpholine-2-carboxylic acid (CAS: 884512-77-0)?

Answer

(R)-4-(tert-butoxycarbonyl)morpholine-2-carboxylic acid
(R)-4-(tert-butoxycarbonyl)morpholine-2-carboxylic acid is a colorless crystalline solid with a molecular weight of approximately 256.34 g/mol. It has a high solubility in organic solvents like DMSO and ethanol, and low solubility in water. This compound is known for its reactivity in esterification and amide formation. It exhibits good stability in air but is susceptible to hydrolysis in basic conditions.

About

English Name (R)-4-(tert-butoxycarbonyl)morpholine-2-carboxylic acid
Molecular Formula C10H17NO5
Molecular Weight 231.25 g/mol
SMILES CC(C)(C)OC(=O)N1CCOC(C1)C(=O)O
InChIKey LGWMTRPJZFEWCX-SSDOTTSWSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

How is (R)-4-(tert-butoxycarbonyl)morpholine-2-carboxylic acid (CAS: 884512-77-0) typically synthesized?

(R)-4-(tert-Butoxycarbonyl)morpholine-2-carboxylic acid can be synthesized through a multi-step proc...

Compound Q&A

What industries use (R)-4-(tert-butoxycarbonyl)morpholine-2-carboxylic acid (CAS: 884512-77-0)?

(R)-4-(tert-Butoxycarbonyl)morpholine-2-carboxylic acid is primarily used in the pharmaceutical and ...

Compound Q&A

What precautions should be taken when handling (R)-4-(tert-butoxycarbonyl)morpholine-2-carboxylic acid (CAS: 884512-77-0)?

When handling (R)-4-(tert-butoxycarbonyl)morpholine-2-carboxylic acid, it is essential to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...