Compound Q&A

What industries use 5-[2-(3-Hydroxy-5-methoxyphenyl)ethyl]-2-methoxyphenol (CAS: 67884-30-4)?

Answer

5-[2-(3-Hydroxy-5-methoxyphenyl)ethyl]-2-methoxyphenol
5-[2-(3-Hydroxy-5-methoxyphenyl)ethyl]-2-methoxyphenol (CAS: 67884-30-4) is used in various industries, particularly in pharmaceuticals and as a precursor for the synthesis of other chemical compounds. It is also utilized in the preparation of materials for sensors, semiconductors, and electronic devices. Its aromatic and hydroxy functionalities make it suitable for a range of applications in the polymer industry and as a molecular probe in analytical chemistry.

About

CAS No 67884-30-4
English Name 5-[2-(3-Hydroxy-5-methoxyphenyl)ethyl]-2-methoxyphenol
Molecular Formula C16H18O4
Molecular Weight 274.32 g/mol
SMILES COc1ccc(cc1O)CCc2cc(cc(c2)OC)O
InChIKey SDXKZPQOVUDXIY-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-[2-(3-Hydroxy-5-methoxyphenyl)ethyl]-2-methoxyphenol (CAS: 67884-30-4)?

5-[2-(3-Hydroxy-5-methoxyphenyl)ethyl]-2-methoxyphenol (CAS: 67884-30-4) is a crystalline compound w...

Compound Q&A

How is 5-[2-(3-Hydroxy-5-methoxyphenyl)ethyl]-2-methoxyphenol (CAS: 67884-30-4) typically synthesized?

5-[2-(3-Hydroxy-5-methoxyphenyl)ethyl]-2-methoxyphenol is typically synthesized via a multi-step pro...

Compound Q&A

What precautions should be taken when handling 5-[2-(3-Hydroxy-5-methoxyphenyl)ethyl]-2-methoxyphenol (CAS: 67884-30-4)?

When handling 5-[2-(3-Hydroxy-5-methoxyphenyl)ethyl]-2-methoxyphenol (CAS: 67884-30-4), it is essent...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...