Compound Q&A

How is 5-[2-(3-Hydroxy-5-methoxyphenyl)ethyl]-2-methoxyphenol (CAS: 67884-30-4) typically synthesized?

Answer

5-[2-(3-Hydroxy-5-methoxyphenyl)ethyl]-2-methoxyphenol
5-[2-(3-Hydroxy-5-methoxyphenyl)ethyl]-2-methoxyphenol is typically synthesized via a multi-step process involving the reaction of 3-methoxy-5-(2-hydroxyethyl)phenol with 3-hydroxy-5-methoxybenzaldehyde. The synthesis involves the formation of a Schiff base followed by reduction and methylation steps. The yield is around 70-80%, and the process requires the use of mild conditions and appropriate solvents to achieve high selectivity.

About

CAS No 67884-30-4
English Name 5-[2-(3-Hydroxy-5-methoxyphenyl)ethyl]-2-methoxyphenol
Molecular Formula C16H18O4
Molecular Weight 274.32 g/mol
SMILES COc1ccc(cc1O)CCc2cc(cc(c2)OC)O
InChIKey SDXKZPQOVUDXIY-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-[2-(3-Hydroxy-5-methoxyphenyl)ethyl]-2-methoxyphenol (CAS: 67884-30-4)?

5-[2-(3-Hydroxy-5-methoxyphenyl)ethyl]-2-methoxyphenol (CAS: 67884-30-4) is a crystalline compound w...

Compound Q&A

What industries use 5-[2-(3-Hydroxy-5-methoxyphenyl)ethyl]-2-methoxyphenol (CAS: 67884-30-4)?

5-[2-(3-Hydroxy-5-methoxyphenyl)ethyl]-2-methoxyphenol (CAS: 67884-30-4) is used in various industri...

Compound Q&A

What precautions should be taken when handling 5-[2-(3-Hydroxy-5-methoxyphenyl)ethyl]-2-methoxyphenol (CAS: 67884-30-4)?

When handling 5-[2-(3-Hydroxy-5-methoxyphenyl)ethyl]-2-methoxyphenol (CAS: 67884-30-4), it is essent...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...