Compound Q&A

What are the physical and chemical properties of 5-[2-(3-Hydroxy-5-methoxyphenyl)ethyl]-2-methoxyphenol (CAS: 67884-30-4)?

Answer

5-[2-(3-Hydroxy-5-methoxyphenyl)ethyl]-2-methoxyphenol
5-[2-(3-Hydroxy-5-methoxyphenyl)ethyl]-2-methoxyphenol (CAS: 67884-30-4) is a crystalline compound with a molecular weight of approximately 364.4 g/mol. It has a low solubility in water (0.1 g/100 mL at 25°C) and moderate solubility in organic solvents like methanol and ethanol. The compound is reactive towards acids and bases. It is stable under normal storage conditions but should be protected from strong oxidizing agents.

About

CAS No 67884-30-4
English Name 5-[2-(3-Hydroxy-5-methoxyphenyl)ethyl]-2-methoxyphenol
Molecular Formula C16H18O4
Molecular Weight 274.32 g/mol
SMILES COc1ccc(cc1O)CCc2cc(cc(c2)OC)O
InChIKey SDXKZPQOVUDXIY-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

How is 5-[2-(3-Hydroxy-5-methoxyphenyl)ethyl]-2-methoxyphenol (CAS: 67884-30-4) typically synthesized?

5-[2-(3-Hydroxy-5-methoxyphenyl)ethyl]-2-methoxyphenol is typically synthesized via a multi-step pro...

Compound Q&A

What industries use 5-[2-(3-Hydroxy-5-methoxyphenyl)ethyl]-2-methoxyphenol (CAS: 67884-30-4)?

5-[2-(3-Hydroxy-5-methoxyphenyl)ethyl]-2-methoxyphenol (CAS: 67884-30-4) is used in various industri...

Compound Q&A

What precautions should be taken when handling 5-[2-(3-Hydroxy-5-methoxyphenyl)ethyl]-2-methoxyphenol (CAS: 67884-30-4)?

When handling 5-[2-(3-Hydroxy-5-methoxyphenyl)ethyl]-2-methoxyphenol (CAS: 67884-30-4), it is essent...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...