Compound Q&A

What precautions should be taken when handling 4-(4-Bromophenyl)dibenzo[b,d]furan (CAS: 955959-84-9)?

Answer

4-(4-Bromophenyl)dibenzo[b,d]furan
When handling 4-(4-Bromophenyl)dibenzo[b,d]furan, it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be stored in a cool, dry place away from direct sunlight. In case of a spill, it should be cleaned up using appropriate absorbents, and the area should be ventilated. Always refer to the Safety Data Sheet (SDS) for specific handling and disposal instructions to ensure safety in the laboratory setting.

About

English Name 4-(4-Bromophenyl)dibenzo[b,d]furan
Molecular Formula C18H11BrO
Molecular Weight 323.19 g/mol
SMILES C1=CC=C2C(=C1)C3=C(O2)C(=CC=C3)C4=CC=C(C=C4)Br
InChIKey RIPZSADLUWTEFQ-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(4-Bromophenyl)dibenzo[b,d]furan (CAS: 955959-84-9)?

4-(4-Bromophenyl)dibenzo[b,d]furan is a crystalline solid with a molecular weight of approximately 3...

Compound Q&A

How is 4-(4-Bromophenyl)dibenzo[b,d]furan (CAS: 955959-84-9) typically synthesized?

4-(4-Bromophenyl)dibenzo[b,d]furan can be synthesized through a multistep process involving the brom...

Compound Q&A

What industries use 4-(4-Bromophenyl)dibenzo[b,d]furan (CAS: 955959-84-9)?

4-(4-Bromophenyl)dibenzo[b,d]furan is primarily used in the pharmaceutical and polymer industries. I...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...