Compound Q&A

How is 4-(4-Bromophenyl)dibenzo[b,d]furan (CAS: 955959-84-9) typically synthesized?

Answer

4-(4-Bromophenyl)dibenzo[b,d]furan
4-(4-Bromophenyl)dibenzo[b,d]furan can be synthesized through a multistep process involving the bromination of a starting aromatic compound followed by a condensation reaction. Commonly used catalysts include Lewis acids, and the reaction typically yields around 75-85% purity. The exact method may vary depending on the specific starting materials and desired purity.

About

English Name 4-(4-Bromophenyl)dibenzo[b,d]furan
Molecular Formula C18H11BrO
Molecular Weight 323.19 g/mol
SMILES C1=CC=C2C(=C1)C3=C(O2)C(=CC=C3)C4=CC=C(C=C4)Br
InChIKey RIPZSADLUWTEFQ-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(4-Bromophenyl)dibenzo[b,d]furan (CAS: 955959-84-9)?

4-(4-Bromophenyl)dibenzo[b,d]furan is a crystalline solid with a molecular weight of approximately 3...

Compound Q&A

What industries use 4-(4-Bromophenyl)dibenzo[b,d]furan (CAS: 955959-84-9)?

4-(4-Bromophenyl)dibenzo[b,d]furan is primarily used in the pharmaceutical and polymer industries. I...

Compound Q&A

What precautions should be taken when handling 4-(4-Bromophenyl)dibenzo[b,d]furan (CAS: 955959-84-9)?

When handling 4-(4-Bromophenyl)dibenzo[b,d]furan, it is essential to wear appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...