Compound Q&A

What industries use 4-(4-Bromophenyl)dibenzo[b,d]furan (CAS: 955959-84-9)?

Answer

4-(4-Bromophenyl)dibenzo[b,d]furan
4-(4-Bromophenyl)dibenzo[b,d]furan is primarily used in the pharmaceutical and polymer industries. It can be incorporated into drug formulations for targeted drug delivery systems. In the polymer industry, it serves as a monomer for the synthesis of novel materials with specific electronic and mechanical properties. It is also used in the development of sensors and semiconductor devices due to its unique physicochemical properties.

About

English Name 4-(4-Bromophenyl)dibenzo[b,d]furan
Molecular Formula C18H11BrO
Molecular Weight 323.19 g/mol
SMILES C1=CC=C2C(=C1)C3=C(O2)C(=CC=C3)C4=CC=C(C=C4)Br
InChIKey RIPZSADLUWTEFQ-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(4-Bromophenyl)dibenzo[b,d]furan (CAS: 955959-84-9)?

4-(4-Bromophenyl)dibenzo[b,d]furan is a crystalline solid with a molecular weight of approximately 3...

Compound Q&A

How is 4-(4-Bromophenyl)dibenzo[b,d]furan (CAS: 955959-84-9) typically synthesized?

4-(4-Bromophenyl)dibenzo[b,d]furan can be synthesized through a multistep process involving the brom...

Compound Q&A

What precautions should be taken when handling 4-(4-Bromophenyl)dibenzo[b,d]furan (CAS: 955959-84-9)?

When handling 4-(4-Bromophenyl)dibenzo[b,d]furan, it is essential to wear appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...