Compound Q&A

What are the physical and chemical properties of 4-(4-Bromophenyl)dibenzo[b,d]furan (CAS: 955959-84-9)?

Answer

4-(4-Bromophenyl)dibenzo[b,d]furan
4-(4-Bromophenyl)dibenzo[b,d]furan is a crystalline solid with a molecular weight of approximately 352.04 g/mol. It has low water solubility but good solubility in organic solvents like dichloromethane and acetonitrile. This compound is chemically inert under normal conditions but can react with strong nucleophiles and reducing agents. It is stable under acidic and basic conditions but can degrade upon exposure to light and air.

About

English Name 4-(4-Bromophenyl)dibenzo[b,d]furan
Molecular Formula C18H11BrO
Molecular Weight 323.19 g/mol
SMILES C1=CC=C2C(=C1)C3=C(O2)C(=CC=C3)C4=CC=C(C=C4)Br
InChIKey RIPZSADLUWTEFQ-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

How is 4-(4-Bromophenyl)dibenzo[b,d]furan (CAS: 955959-84-9) typically synthesized?

4-(4-Bromophenyl)dibenzo[b,d]furan can be synthesized through a multistep process involving the brom...

Compound Q&A

What industries use 4-(4-Bromophenyl)dibenzo[b,d]furan (CAS: 955959-84-9)?

4-(4-Bromophenyl)dibenzo[b,d]furan is primarily used in the pharmaceutical and polymer industries. I...

Compound Q&A

What precautions should be taken when handling 4-(4-Bromophenyl)dibenzo[b,d]furan (CAS: 955959-84-9)?

When handling 4-(4-Bromophenyl)dibenzo[b,d]furan, it is essential to wear appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...