Compound Q&A

What industries use 3-{[(3-Chlorophenyl)sulfonyl]amino}benzoic acid (CAS: 78922-04-0)?

Answer

3-{[(3-Chlorophenyl)sulfonyl]amino}benzoic acid
3-{[(3-Chlorophenyl)sulfonyl]amino}benzoic acid is often used in the pharmaceutical industry for the synthesis of various drugs. It also has applications in the polymer industry for modifying properties of polymers, in sensor technology for detecting specific compounds, and in semiconductor manufacturing for etching and cleaning processes.

About

CAS No 78922-04-0
English Name 3-{[(3-Chlorophenyl)sulfonyl]amino}benzoic acid
Molecular Formula C13H10ClNO4S
Molecular Weight 311.74 g/mol
SMILES C1=CC(=CC(=C1)NS(=O)(=O)C2=CC(=CC=C2)Cl)C(=O)O
InChIKey APBOVLPLJFJSRI-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-{[(3-Chlorophenyl)sulfonyl]amino}benzoic acid (CAS: 78922-04-0)?

3-{[(3-Chlorophenyl)sulfonyl]amino}benzoic acid is a crystalline solid with a molecular weight of ap...

Compound Q&A

How is 3-{[(3-Chlorophenyl)sulfonyl]amino}benzoic acid (CAS: 78922-04-0) typically synthesized?

3-{[(3-Chlorophenyl)sulfonyl]amino}benzoic acid is typically synthesized via a multi-step reaction i...

Compound Q&A

What precautions should be taken when handling 3-{[(3-Chlorophenyl)sulfonyl]amino}benzoic acid (CAS: 78922-04-0)?

When handling 3-{[(3-Chlorophenyl)sulfonyl]amino}benzoic acid, it is important to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...