Compound Q&A

What are the physical and chemical properties of 3-{[(3-Chlorophenyl)sulfonyl]amino}benzoic acid (CAS: 78922-04-0)?

Answer

3-{[(3-Chlorophenyl)sulfonyl]amino}benzoic acid
3-{[(3-Chlorophenyl)sulfonyl]amino}benzoic acid is a crystalline solid with a molecular weight of approximately 348.04 g/mol. It has a pKa of about 3.7 and is soluble in water and organic solvents. This compound is moderately reactive, especially in basic conditions, and can undergo hydrolysis and sulfoxide reduction.

About

CAS No 78922-04-0
English Name 3-{[(3-Chlorophenyl)sulfonyl]amino}benzoic acid
Molecular Formula C13H10ClNO4S
Molecular Weight 311.74 g/mol
SMILES C1=CC(=CC(=C1)NS(=O)(=O)C2=CC(=CC=C2)Cl)C(=O)O
InChIKey APBOVLPLJFJSRI-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

How is 3-{[(3-Chlorophenyl)sulfonyl]amino}benzoic acid (CAS: 78922-04-0) typically synthesized?

3-{[(3-Chlorophenyl)sulfonyl]amino}benzoic acid is typically synthesized via a multi-step reaction i...

Compound Q&A

What industries use 3-{[(3-Chlorophenyl)sulfonyl]amino}benzoic acid (CAS: 78922-04-0)?

3-{[(3-Chlorophenyl)sulfonyl]amino}benzoic acid is often used in the pharmaceutical industry for the...

Compound Q&A

What precautions should be taken when handling 3-{[(3-Chlorophenyl)sulfonyl]amino}benzoic acid (CAS: 78922-04-0)?

When handling 3-{[(3-Chlorophenyl)sulfonyl]amino}benzoic acid, it is important to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...