Compound Q&A

How is 3-{[(3-Chlorophenyl)sulfonyl]amino}benzoic acid (CAS: 78922-04-0) typically synthesized?

Answer

3-{[(3-Chlorophenyl)sulfonyl]amino}benzoic acid
3-{[(3-Chlorophenyl)sulfonyl]amino}benzoic acid is typically synthesized via a multi-step reaction involving the coupling of 3-chlorobenzenesulfonyl chloride with an amino derivative of benzoic acid. Common synthetic methods include the use of coupling agents and bases, with yields generally ranging from 60% to 80%.

About

CAS No 78922-04-0
English Name 3-{[(3-Chlorophenyl)sulfonyl]amino}benzoic acid
Molecular Formula C13H10ClNO4S
Molecular Weight 311.74 g/mol
SMILES C1=CC(=CC(=C1)NS(=O)(=O)C2=CC(=CC=C2)Cl)C(=O)O
InChIKey APBOVLPLJFJSRI-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-{[(3-Chlorophenyl)sulfonyl]amino}benzoic acid (CAS: 78922-04-0)?

3-{[(3-Chlorophenyl)sulfonyl]amino}benzoic acid is a crystalline solid with a molecular weight of ap...

Compound Q&A

What industries use 3-{[(3-Chlorophenyl)sulfonyl]amino}benzoic acid (CAS: 78922-04-0)?

3-{[(3-Chlorophenyl)sulfonyl]amino}benzoic acid is often used in the pharmaceutical industry for the...

Compound Q&A

What precautions should be taken when handling 3-{[(3-Chlorophenyl)sulfonyl]amino}benzoic acid (CAS: 78922-04-0)?

When handling 3-{[(3-Chlorophenyl)sulfonyl]amino}benzoic acid, it is important to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...