Compound Q&A

What industries use Amorolfine (CAS: 78613-35-1)?

Answer

Amorolfine
Amorolfine (CAS: 78613-35-1) is primarily used in the pharmaceutical industry, particularly in dermatological applications as a topical antifungal agent. It is also used in research for studying fungal infections and developing antifungal therapies.

About

CAS No 78613-35-1
English Name Amorolfine
Molecular Formula C21H35NO
Molecular Weight 317.52 g/mol
SMILES CCC(C)(C)c1ccc(CC(C)CN2C[C@H](C)O[C@H](C)C2)cc1
InChIKey MQHLMHIZUIDKOO-AYHJJNSGSA-N
Last Updated: 2025-10-10 19:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of Amorolfine (CAS: 78613-35-1)?

Amorolfine (CAS: 78613-35-1) is a crystalline compound with a molecular weight of approximately 273....

Compound Q&A

How is Amorolfine (CAS: 78613-35-1) typically synthesized?

Amorolfine (CAS: 78613-35-1) is typically synthesized via a multistep process, starting from 2-(3-br...

Compound Q&A

What precautions should be taken when handling Amorolfine (CAS: 78613-35-1)?

When handling Amorolfine (CAS: 78613-35-1), it is essential to wear appropriate personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...