Compound Q&A

What are the physical and chemical properties of Amorolfine (CAS: 78613-35-1)?

Answer

Amorolfine
Amorolfine (CAS: 78613-35-1) is a crystalline compound with a molecular weight of approximately 273.28 g/mol. It has limited water solubility and is sparingly soluble in organic solvents such as ethanol and acetone. Amorolfine is relatively stable under normal storage conditions but reacts with strong bases and reducing agents. It is primarily used as a topical antifungal agent in dermatological applications.

About

CAS No 78613-35-1
English Name Amorolfine
Molecular Formula C21H35NO
Molecular Weight 317.52 g/mol
SMILES CCC(C)(C)c1ccc(CC(C)CN2C[C@H](C)O[C@H](C)C2)cc1
InChIKey MQHLMHIZUIDKOO-AYHJJNSGSA-N
Last Updated: 2025-10-10 19:08

Related Q&A

Compound Q&A

How is Amorolfine (CAS: 78613-35-1) typically synthesized?

Amorolfine (CAS: 78613-35-1) is typically synthesized via a multistep process, starting from 2-(3-br...

Compound Q&A

What industries use Amorolfine (CAS: 78613-35-1)?

Amorolfine (CAS: 78613-35-1) is primarily used in the pharmaceutical industry, particularly in derma...

Compound Q&A

What precautions should be taken when handling Amorolfine (CAS: 78613-35-1)?

When handling Amorolfine (CAS: 78613-35-1), it is essential to wear appropriate personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...