Compound Q&A

What industries use Ethyl L-tryptophanate hydrochloride (CAS: 2899-28-7)?

Answer

Ethyl L-tryptophanate hydrochloride (1:1)
Ethyl L-tryptophanate hydrochloride (CAS: 2899-28-7) is primarily used in the pharmaceutical industry for the synthesis of certain drugs. It is also used in the food industry as a flavoring agent and in the cosmetic industry for developing skin care products. The compound's ability to act as a precursor in the production of tryptophan analogs makes it valuable in various applications.

About

CAS No 2899-28-7
English Name Ethyl L-tryptophanate hydrochloride (1:1)
Molecular Formula C13H17ClN2O2
Molecular Weight 268.74 g/mol
SMILES CCOC(=O)C(CC1=CNC2=CC=CC=C21)N.Cl
InChIKey PESYCVVSLYSXAK-MERQFXBCSA-N
Last Updated: 2025-10-10 19:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl L-tryptophanate hydrochloride (CAS: 2899-28-7)?

Ethyl L-tryptophanate hydrochloride (CAS: 2899-28-7) is a crystalline compound with a molecular weig...

Compound Q&A

How is Ethyl L-tryptophanate hydrochloride (CAS: 2899-28-7) typically synthesized?

Ethyl L-tryptophanate hydrochloride (CAS: 2899-28-7) is typically synthesized by reacting L-tryptoph...

Compound Q&A

What precautions should be taken when handling Ethyl L-tryptophanate hydrochloride (CAS: 2899-28-7)?

When handling Ethyl L-tryptophanate hydrochloride (CAS: 2899-28-7), it is essential to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...