Compound Q&A

What are the physical and chemical properties of Ethyl L-tryptophanate hydrochloride (CAS: 2899-28-7)?

Answer

Ethyl L-tryptophanate hydrochloride (1:1)
Ethyl L-tryptophanate hydrochloride (CAS: 2899-28-7) is a crystalline compound with a molecular weight of approximately 287.8 g/mol. It is soluble in water and ethanol but less soluble in organic solvents. The compound exhibits basic properties due to the presence of the hydrochloride salt. It is relatively stable under normal conditions but can react with bases to form the free base. It has a melting point of about 210-215°C and is used in pharmaceutical formulations.

About

CAS No 2899-28-7
English Name Ethyl L-tryptophanate hydrochloride (1:1)
Molecular Formula C13H17ClN2O2
Molecular Weight 268.74 g/mol
SMILES CCOC(=O)C(CC1=CNC2=CC=CC=C21)N.Cl
InChIKey PESYCVVSLYSXAK-MERQFXBCSA-N
Last Updated: 2025-10-10 19:08

Related Q&A

Compound Q&A

How is Ethyl L-tryptophanate hydrochloride (CAS: 2899-28-7) typically synthesized?

Ethyl L-tryptophanate hydrochloride (CAS: 2899-28-7) is typically synthesized by reacting L-tryptoph...

Compound Q&A

What industries use Ethyl L-tryptophanate hydrochloride (CAS: 2899-28-7)?

Ethyl L-tryptophanate hydrochloride (CAS: 2899-28-7) is primarily used in the pharmaceutical industr...

Compound Q&A

What precautions should be taken when handling Ethyl L-tryptophanate hydrochloride (CAS: 2899-28-7)?

When handling Ethyl L-tryptophanate hydrochloride (CAS: 2899-28-7), it is essential to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...