Compound Q&A

How is Ethyl L-tryptophanate hydrochloride (CAS: 2899-28-7) typically synthesized?

Answer

Ethyl L-tryptophanate hydrochloride (1:1)
Ethyl L-tryptophanate hydrochloride (CAS: 2899-28-7) is typically synthesized by reacting L-tryptophan with ethyl chloroacetate in the presence of a base like sodium hydroxide. The process involves a condensation reaction followed by the addition of hydrochloric acid to form the hydrochloride salt. The reaction is carried out in an appropriate solvent, and the product is isolated by crystallization. The yield is generally around 80-90%.

About

CAS No 2899-28-7
English Name Ethyl L-tryptophanate hydrochloride (1:1)
Molecular Formula C13H17ClN2O2
Molecular Weight 268.74 g/mol
SMILES CCOC(=O)C(CC1=CNC2=CC=CC=C21)N.Cl
InChIKey PESYCVVSLYSXAK-MERQFXBCSA-N
Last Updated: 2025-10-10 19:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl L-tryptophanate hydrochloride (CAS: 2899-28-7)?

Ethyl L-tryptophanate hydrochloride (CAS: 2899-28-7) is a crystalline compound with a molecular weig...

Compound Q&A

What industries use Ethyl L-tryptophanate hydrochloride (CAS: 2899-28-7)?

Ethyl L-tryptophanate hydrochloride (CAS: 2899-28-7) is primarily used in the pharmaceutical industr...

Compound Q&A

What precautions should be taken when handling Ethyl L-tryptophanate hydrochloride (CAS: 2899-28-7)?

When handling Ethyl L-tryptophanate hydrochloride (CAS: 2899-28-7), it is essential to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...