Compound Q&A

What industries use 1-[4-(Benzyloxy)-3-nitrophenyl]ethanone (CAS: 14347-05-8)?

Answer

1-[4-(Benzyloxy)-3-nitrophenyl]ethanone
1-[4-(Benzyloxy)-3-nitrophenyl]ethanone is used in pharmaceuticals for the synthesis of intermediates and in the polymer industry for the development of new materials. It also finds applications in the field of sensors and as a precursor in semiconductor manufacturing.

About

CAS No 14347-05-8
English Name 1-[4-(Benzyloxy)-3-nitrophenyl]ethanone
Molecular Formula C15H13NO4
Molecular Weight 271.27 g/mol
SMILES CC(=O)C1=CC(=C(C=C1)OCC2=CC=CC=C2)[N+](=O)[O-]
InChIKey OWKGFSOHSDMRJL-UHFFFAOYSA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-[4-(Benzyloxy)-3-nitrophenyl]ethanone (CAS: 14347-05-8)?

1-[4-(Benzyloxy)-3-nitrophenyl]ethanone is a crystalline compound with a molecular weight of approxi...

Compound Q&A

How is 1-[4-(Benzyloxy)-3-nitrophenyl]ethanone (CAS: 14347-05-8) typically synthesized?

1-[4-(Benzyloxy)-3-nitrophenyl]ethanone is typically synthesized via a multistep process starting fr...

Compound Q&A

What precautions should be taken when handling 1-[4-(Benzyloxy)-3-nitrophenyl]ethanone (CAS: 14347-05-8)?

Handling 1-[4-(Benzyloxy)-3-nitrophenyl]ethanone requires the use of personal protective equipment (...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...