Compound Q&A

What are the physical and chemical properties of 1-[4-(Benzyloxy)-3-nitrophenyl]ethanone (CAS: 14347-05-8)?

Answer

1-[4-(Benzyloxy)-3-nitrophenyl]ethanone
1-[4-(Benzyloxy)-3-nitrophenyl]ethanone is a crystalline compound with a molecular weight of approximately 328.28 g/mol. It has a low solubility in water but is soluble in organic solvents like ethanol and acetone. Chemically, it is reactive, particularly towards nucleophiles and reductants. It is stable under normal laboratory conditions but requires protection from light.

About

CAS No 14347-05-8
English Name 1-[4-(Benzyloxy)-3-nitrophenyl]ethanone
Molecular Formula C15H13NO4
Molecular Weight 271.27 g/mol
SMILES CC(=O)C1=CC(=C(C=C1)OCC2=CC=CC=C2)[N+](=O)[O-]
InChIKey OWKGFSOHSDMRJL-UHFFFAOYSA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

How is 1-[4-(Benzyloxy)-3-nitrophenyl]ethanone (CAS: 14347-05-8) typically synthesized?

1-[4-(Benzyloxy)-3-nitrophenyl]ethanone is typically synthesized via a multistep process starting fr...

Compound Q&A

What industries use 1-[4-(Benzyloxy)-3-nitrophenyl]ethanone (CAS: 14347-05-8)?

1-[4-(Benzyloxy)-3-nitrophenyl]ethanone is used in pharmaceuticals for the synthesis of intermediate...

Compound Q&A

What precautions should be taken when handling 1-[4-(Benzyloxy)-3-nitrophenyl]ethanone (CAS: 14347-05-8)?

Handling 1-[4-(Benzyloxy)-3-nitrophenyl]ethanone requires the use of personal protective equipment (...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...