Compound Q&A

How is 1-[4-(Benzyloxy)-3-nitrophenyl]ethanone (CAS: 14347-05-8) typically synthesized?

Answer

1-[4-(Benzyloxy)-3-nitrophenyl]ethanone
1-[4-(Benzyloxy)-3-nitrophenyl]ethanone is typically synthesized via a multistep process starting from benzoic acid. The reaction involves the formation of a benzyloxy derivative, followed by nitration, and then acetylation. The synthesis is carried out under mild conditions with good yields and selectivity.

About

CAS No 14347-05-8
English Name 1-[4-(Benzyloxy)-3-nitrophenyl]ethanone
Molecular Formula C15H13NO4
Molecular Weight 271.27 g/mol
SMILES CC(=O)C1=CC(=C(C=C1)OCC2=CC=CC=C2)[N+](=O)[O-]
InChIKey OWKGFSOHSDMRJL-UHFFFAOYSA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-[4-(Benzyloxy)-3-nitrophenyl]ethanone (CAS: 14347-05-8)?

1-[4-(Benzyloxy)-3-nitrophenyl]ethanone is a crystalline compound with a molecular weight of approxi...

Compound Q&A

What industries use 1-[4-(Benzyloxy)-3-nitrophenyl]ethanone (CAS: 14347-05-8)?

1-[4-(Benzyloxy)-3-nitrophenyl]ethanone is used in pharmaceuticals for the synthesis of intermediate...

Compound Q&A

What precautions should be taken when handling 1-[4-(Benzyloxy)-3-nitrophenyl]ethanone (CAS: 14347-05-8)?

Handling 1-[4-(Benzyloxy)-3-nitrophenyl]ethanone requires the use of personal protective equipment (...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...