Compound Q&A

What precautions should be taken when handling 3-bromo-5-(trifluoromethyl)benzoic acid (CAS: 328-67-6)?

Answer

3-bromo-5-(trifluoromethyl)benzoic acid
When handling 3-bromo-5-(trifluoromethyl)benzoic acid (CAS: 328-67-6), it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and lab coats. This compound requires handling in a fume hood due to its volatility and potential for inhalation hazards. Spills should be managed using appropriate absorbent materials and washed down with water. Always refer to the Safety Data Sheet (SDS) for detailed emergency procedures and storage recommendations to ensure safe handling and disposal. Avoid direct contact with skin and eyes, and ensure good ventilation in the work area.

About

CAS No 328-67-6
English Name 3-bromo-5-(trifluoromethyl)benzoic acid
Molecular Formula C8H4BrF3O2
Molecular Weight 269.02 g/mol
SMILES C1=C(C=C(C=C1C(F)(F)F)Br)C(=O)O
InChIKey AMZBKZQMAZWIJM-UHFFFAOYSA-N
Last Updated: 2025-10-10 12:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-bromo-5-(trifluoromethyl)benzoic acid (CAS: 328-67-6)?

3-Bromo-5-(trifluoromethyl)benzoic acid (CAS: 328-67-6) is a white crystalline solid at room tempera...

Compound Q&A

How is 3-bromo-5-(trifluoromethyl)benzoic acid (CAS: 328-67-6) typically synthesized?

3-Bromo-5-(trifluoromethyl)benzoic acid is typically synthesized through a multi-step process. Start...

Compound Q&A

What industries use 3-bromo-5-(trifluoromethyl)benzoic acid (CAS: 328-67-6)?

3-Bromo-5-(trifluoromethyl)benzoic acid (CAS: 328-67-6) finds applications in various industries. It...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...