Compound Q&A

How is 3-bromo-5-(trifluoromethyl)benzoic acid (CAS: 328-67-6) typically synthesized?

Answer

3-bromo-5-(trifluoromethyl)benzoic acid
3-Bromo-5-(trifluoromethyl)benzoic acid is typically synthesized through a multi-step process. Starting from benzoic acid, a trifluoromethyl group is introduced using an appropriate trifluoromethylating agent such as triflic anhydride. The resulting intermediate is then brominated using N-bromosuccinimide (NBS) or similar reagents. The reaction conditions include the use of a radical initiator and careful control of temperature to achieve a high yield and good selectivity.

About

CAS No 328-67-6
English Name 3-bromo-5-(trifluoromethyl)benzoic acid
Molecular Formula C8H4BrF3O2
Molecular Weight 269.02 g/mol
SMILES C1=C(C=C(C=C1C(F)(F)F)Br)C(=O)O
InChIKey AMZBKZQMAZWIJM-UHFFFAOYSA-N
Last Updated: 2025-10-10 12:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-bromo-5-(trifluoromethyl)benzoic acid (CAS: 328-67-6)?

3-Bromo-5-(trifluoromethyl)benzoic acid (CAS: 328-67-6) is a white crystalline solid at room tempera...

Compound Q&A

What industries use 3-bromo-5-(trifluoromethyl)benzoic acid (CAS: 328-67-6)?

3-Bromo-5-(trifluoromethyl)benzoic acid (CAS: 328-67-6) finds applications in various industries. It...

Compound Q&A

What precautions should be taken when handling 3-bromo-5-(trifluoromethyl)benzoic acid (CAS: 328-67-6)?

When handling 3-bromo-5-(trifluoromethyl)benzoic acid (CAS: 328-67-6), it is essential to use approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...