Compound Q&A

What are the physical and chemical properties of 3-bromo-5-(trifluoromethyl)benzoic acid (CAS: 328-67-6)?

Answer

3-bromo-5-(trifluoromethyl)benzoic acid
3-Bromo-5-(trifluoromethyl)benzoic acid (CAS: 328-67-6) is a white crystalline solid at room temperature. Its molecular weight is approximately 286.04 g/mol. This compound is slightly soluble in water and more soluble in organic solvents like ethanol and acetonitrile. It is moderately reactive, showing mild acidity and can undergo typical carboxylic acid reactions such as esterification and acylation. It is also prone to bromination and trifluoromethylation reactions.

About

CAS No 328-67-6
English Name 3-bromo-5-(trifluoromethyl)benzoic acid
Molecular Formula C8H4BrF3O2
Molecular Weight 269.02 g/mol
SMILES C1=C(C=C(C=C1C(F)(F)F)Br)C(=O)O
InChIKey AMZBKZQMAZWIJM-UHFFFAOYSA-N
Last Updated: 2025-10-10 12:21

Related Q&A

Compound Q&A

How is 3-bromo-5-(trifluoromethyl)benzoic acid (CAS: 328-67-6) typically synthesized?

3-Bromo-5-(trifluoromethyl)benzoic acid is typically synthesized through a multi-step process. Start...

Compound Q&A

What industries use 3-bromo-5-(trifluoromethyl)benzoic acid (CAS: 328-67-6)?

3-Bromo-5-(trifluoromethyl)benzoic acid (CAS: 328-67-6) finds applications in various industries. It...

Compound Q&A

What precautions should be taken when handling 3-bromo-5-(trifluoromethyl)benzoic acid (CAS: 328-67-6)?

When handling 3-bromo-5-(trifluoromethyl)benzoic acid (CAS: 328-67-6), it is essential to use approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...