Compound Q&A

What industries use 3-bromo-5-(trifluoromethyl)benzoic acid (CAS: 328-67-6)?

Answer

3-bromo-5-(trifluoromethyl)benzoic acid
3-Bromo-5-(trifluoromethyl)benzoic acid (CAS: 328-67-6) finds applications in various industries. It is primarily used in the pharmaceutical and polymer industries due to its reactivity and ability to form stable derivatives. In the pharmaceutical sector, it serves as a precursor for the synthesis of complex organic molecules used in drug development. In the polymer industry, it is utilized in the synthesis of advanced materials with unique properties. Additionally, it is used in sensor technologies and semiconductor manufacturing for its chemical stability and reactivity.

About

CAS No 328-67-6
English Name 3-bromo-5-(trifluoromethyl)benzoic acid
Molecular Formula C8H4BrF3O2
Molecular Weight 269.02 g/mol
SMILES C1=C(C=C(C=C1C(F)(F)F)Br)C(=O)O
InChIKey AMZBKZQMAZWIJM-UHFFFAOYSA-N
Last Updated: 2025-10-10 12:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-bromo-5-(trifluoromethyl)benzoic acid (CAS: 328-67-6)?

3-Bromo-5-(trifluoromethyl)benzoic acid (CAS: 328-67-6) is a white crystalline solid at room tempera...

Compound Q&A

How is 3-bromo-5-(trifluoromethyl)benzoic acid (CAS: 328-67-6) typically synthesized?

3-Bromo-5-(trifluoromethyl)benzoic acid is typically synthesized through a multi-step process. Start...

Compound Q&A

What precautions should be taken when handling 3-bromo-5-(trifluoromethyl)benzoic acid (CAS: 328-67-6)?

When handling 3-bromo-5-(trifluoromethyl)benzoic acid (CAS: 328-67-6), it is essential to use approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...