Compound Q&A

What industries use 4-Chloro-2-nitropyridine (CAS: 65370-42-5)?

Answer

4-Chloro-2-nitropyridine
4-Chloro-2-nitropyridine is primarily used in the pharmaceutical industry for the synthesis of various drug intermediates. It is also utilized in the polymer industry for the development of new materials and in the sensor industry for its sensitivity to certain chemical species. Additionally, it has applications in the semiconductor industry for its use in thin film deposition processes.

About

CAS No 65370-42-5
English Name 4-Chloro-2-nitropyridine
Molecular Formula C5H3ClN2O2
Molecular Weight 158.54 g/mol
SMILES C1=CN=C(C=C1Cl)[N+](=O)[O-]
InChIKey YPKBJRKFGYVURL-UHFFFAOYSA-N
Last Updated: 2025-10-10 12:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Chloro-2-nitropyridine (CAS: 65370-42-5)?

4-Chloro-2-nitropyridine is a crystalline solid with a molecular weight of approximately 177.58 g/mo...

Compound Q&A

How is 4-Chloro-2-nitropyridine (CAS: 65370-42-5) typically synthesized?

4-Chloro-2-nitropyridine is typically synthesized via the nitration of 4-chloropyridine. This proces...

Compound Q&A

What precautions should be taken when handling 4-Chloro-2-nitropyridine (CAS: 65370-42-5)?

Proper handling of 4-Chloro-2-nitropyridine requires the use of personal protective equipment (PPE) ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...