Compound Q&A

How is 4-Chloro-2-nitropyridine (CAS: 65370-42-5) typically synthesized?

Answer

4-Chloro-2-nitropyridine
4-Chloro-2-nitropyridine is typically synthesized via the nitration of 4-chloropyridine. This process involves the use of nitric acid and sulfuric acid as the nitrating agent. The yield can vary depending on the reaction conditions, but the process is generally straightforward and can achieve high selectivity and yield under optimal conditions.

About

CAS No 65370-42-5
English Name 4-Chloro-2-nitropyridine
Molecular Formula C5H3ClN2O2
Molecular Weight 158.54 g/mol
SMILES C1=CN=C(C=C1Cl)[N+](=O)[O-]
InChIKey YPKBJRKFGYVURL-UHFFFAOYSA-N
Last Updated: 2025-10-10 12:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Chloro-2-nitropyridine (CAS: 65370-42-5)?

4-Chloro-2-nitropyridine is a crystalline solid with a molecular weight of approximately 177.58 g/mo...

Compound Q&A

What industries use 4-Chloro-2-nitropyridine (CAS: 65370-42-5)?

4-Chloro-2-nitropyridine is primarily used in the pharmaceutical industry for the synthesis of vario...

Compound Q&A

What precautions should be taken when handling 4-Chloro-2-nitropyridine (CAS: 65370-42-5)?

Proper handling of 4-Chloro-2-nitropyridine requires the use of personal protective equipment (PPE) ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...