Compound Q&A

What are the physical and chemical properties of 4-Chloro-2-nitropyridine (CAS: 65370-42-5)?

Answer

4-Chloro-2-nitropyridine
4-Chloro-2-nitropyridine is a crystalline solid with a molecular weight of approximately 177.58 g/mol. It is slightly soluble in water but readily soluble in organic solvents such as ethanol and acetone. Chemically, it exhibits basic properties due to the nitro group and is prone to hydrolysis under basic conditions. It is also reactive towards nucleophiles and can undergo substitution reactions.

About

CAS No 65370-42-5
English Name 4-Chloro-2-nitropyridine
Molecular Formula C5H3ClN2O2
Molecular Weight 158.54 g/mol
SMILES C1=CN=C(C=C1Cl)[N+](=O)[O-]
InChIKey YPKBJRKFGYVURL-UHFFFAOYSA-N
Last Updated: 2025-10-10 12:21

Related Q&A

Compound Q&A

How is 4-Chloro-2-nitropyridine (CAS: 65370-42-5) typically synthesized?

4-Chloro-2-nitropyridine is typically synthesized via the nitration of 4-chloropyridine. This proces...

Compound Q&A

What industries use 4-Chloro-2-nitropyridine (CAS: 65370-42-5)?

4-Chloro-2-nitropyridine is primarily used in the pharmaceutical industry for the synthesis of vario...

Compound Q&A

What precautions should be taken when handling 4-Chloro-2-nitropyridine (CAS: 65370-42-5)?

Proper handling of 4-Chloro-2-nitropyridine requires the use of personal protective equipment (PPE) ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...