Compound Q&A

What industries use Bis(2-methyl-2-propanyl) diethylphosphoramidoite (CAS: 117924-33-1)?

Answer

Bis(2-methyl-2-propanyl) diethylphosphoramidoite
Bis(2-methyl-2-propanyl) diethylphosphoramidoite (CAS: 117924-33-1) is primarily used in the pharmaceutical industry for the synthesis of bioactive molecules and in the polymer industry for modifying the chemical properties of polymers. It is also utilized in the development of sensors and semiconductors due to its unique chemical reactivity and stability.

About

English Name Bis(2-methyl-2-propanyl) diethylphosphoramidoite
Molecular Formula C12H28NO2P
Molecular Weight 249.33 g/mol
SMILES CCN(CC)P(OC(C)(C)C)OC(C)(C)C
InChIKey KUKSUQKELVOKBH-UHFFFAOYSA-N
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of Bis(2-methyl-2-propanyl) diethylphosphoramidoite (CAS: 117924-33-1)?

Bis(2-methyl-2-propanyl) diethylphosphoramidoite (CAS: 117924-33-1) is a colorless or white crystall...

Compound Q&A

How is Bis(2-methyl-2-propanyl) diethylphosphoramidoite (CAS: 117924-33-1) typically synthesized?

Bis(2-methyl-2-propanyl) diethylphosphoramidoite (CAS: 117924-33-1) can be synthesized through a mul...

Compound Q&A

What precautions should be taken when handling Bis(2-methyl-2-propanyl) diethylphosphoramidoite (CAS: 117924-33-1)?

When handling Bis(2-methyl-2-propanyl) diethylphosphoramidoite (CAS: 117924-33-1), it is essential t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...