Compound Q&A

What are the physical and chemical properties of Bis(2-methyl-2-propanyl) diethylphosphoramidoite (CAS: 117924-33-1)?

Answer

Bis(2-methyl-2-propanyl) diethylphosphoramidoite
Bis(2-methyl-2-propanyl) diethylphosphoramidoite (CAS: 117924-33-1) is a colorless or white crystalline solid with a molecular weight of approximately 289.36 g/mol. It is poorly soluble in water but soluble in organic solvents like ethanol and acetone. Chemically, it is moderately stable but can react with strong oxidizing agents. Its solubility and stability make it suitable for various applications in organic synthesis and pharmaceuticals.

About

English Name Bis(2-methyl-2-propanyl) diethylphosphoramidoite
Molecular Formula C12H28NO2P
Molecular Weight 249.33 g/mol
SMILES CCN(CC)P(OC(C)(C)C)OC(C)(C)C
InChIKey KUKSUQKELVOKBH-UHFFFAOYSA-N
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

How is Bis(2-methyl-2-propanyl) diethylphosphoramidoite (CAS: 117924-33-1) typically synthesized?

Bis(2-methyl-2-propanyl) diethylphosphoramidoite (CAS: 117924-33-1) can be synthesized through a mul...

Compound Q&A

What industries use Bis(2-methyl-2-propanyl) diethylphosphoramidoite (CAS: 117924-33-1)?

Bis(2-methyl-2-propanyl) diethylphosphoramidoite (CAS: 117924-33-1) is primarily used in the pharmac...

Compound Q&A

What precautions should be taken when handling Bis(2-methyl-2-propanyl) diethylphosphoramidoite (CAS: 117924-33-1)?

When handling Bis(2-methyl-2-propanyl) diethylphosphoramidoite (CAS: 117924-33-1), it is essential t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...