Compound Q&A

How is Bis(2-methyl-2-propanyl) diethylphosphoramidoite (CAS: 117924-33-1) typically synthesized?

Answer

Bis(2-methyl-2-propanyl) diethylphosphoramidoite
Bis(2-methyl-2-propanyl) diethylphosphoramidoite (CAS: 117924-33-1) can be synthesized through a multi-step process involving the reaction of diethyl phosphoramidite with a 2-methyl-2-propanol derivative. The synthesis typically requires the use of a catalyst such as a metal complex to enhance the reaction selectivity and yield. The process is carried out under mild conditions to avoid degradation of the product.

About

English Name Bis(2-methyl-2-propanyl) diethylphosphoramidoite
Molecular Formula C12H28NO2P
Molecular Weight 249.33 g/mol
SMILES CCN(CC)P(OC(C)(C)C)OC(C)(C)C
InChIKey KUKSUQKELVOKBH-UHFFFAOYSA-N
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of Bis(2-methyl-2-propanyl) diethylphosphoramidoite (CAS: 117924-33-1)?

Bis(2-methyl-2-propanyl) diethylphosphoramidoite (CAS: 117924-33-1) is a colorless or white crystall...

Compound Q&A

What industries use Bis(2-methyl-2-propanyl) diethylphosphoramidoite (CAS: 117924-33-1)?

Bis(2-methyl-2-propanyl) diethylphosphoramidoite (CAS: 117924-33-1) is primarily used in the pharmac...

Compound Q&A

What precautions should be taken when handling Bis(2-methyl-2-propanyl) diethylphosphoramidoite (CAS: 117924-33-1)?

When handling Bis(2-methyl-2-propanyl) diethylphosphoramidoite (CAS: 117924-33-1), it is essential t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...