Compound Q&A

What industries use Methyl 4-acetamido-5-chloro-2,3-dihydrobenzofuran-7-carboxylate (CAS: 143878-29-9)?

Answer

Methyl 4-acetamido-5-chloro-2,3-dihydrobenzofuran-7-carboxylate
Methyl 4-acetamido-5-chloro-2,3-dihydrobenzofuran-7-carboxylate is primarily used in the pharmaceutical industry for the synthesis of certain drugs. It is also used in the polymer industry for creating specialty polymers with specific properties. Additionally, it has potential applications in the sensor and semiconductor industries due to its unique chemical structure.

About

English Name Methyl 4-acetamido-5-chloro-2,3-dihydrobenzofuran-7-carboxylate
Molecular Formula C12H12ClNO4
Molecular Weight 269.68 g/mol
SMILES CC(=O)NC1=C(C=C(C2=C1CCO2)C(=O)OC)Cl
InChIKey LCPRNYGRYCDBOM-UHFFFAOYSA-N
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 4-acetamido-5-chloro-2,3-dihydrobenzofuran-7-carboxylate (CAS: 143878-29-9)?

Methyl 4-acetamido-5-chloro-2,3-dihydrobenzofuran-7-carboxylate is a white crystalline solid. Its mo...

Compound Q&A

How is Methyl 4-acetamido-5-chloro-2,3-dihydrobenzofuran-7-carboxylate (CAS: 143878-29-9) typically synthesized?

Methyl 4-acetamido-5-chloro-2,3-dihydrobenzofuran-7-carboxylate is typically synthesized by reacting...

Compound Q&A

What precautions should be taken when handling Methyl 4-acetamido-5-chloro-2,3-dihydrobenzofuran-7-carboxylate (CAS: 143878-29-9)?

When handling Methyl 4-acetamido-5-chloro-2,3-dihydrobenzofuran-7-carboxylate, it is essential to we...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...