Compound Q&A

How is Methyl 4-acetamido-5-chloro-2,3-dihydrobenzofuran-7-carboxylate (CAS: 143878-29-9) typically synthesized?

Answer

Methyl 4-acetamido-5-chloro-2,3-dihydrobenzofuran-7-carboxylate
Methyl 4-acetamido-5-chloro-2,3-dihydrobenzofuran-7-carboxylate is typically synthesized by reacting 5-chloro-2,3-dihydrobenzofuran-7-carboxylic acid with acetamide in the presence of a coupling agent like 1-ethyl-3-(3-dimethylaminopropyl) carbodiimide (EDC) and N-hydroxysuccinimide (NHS). The reaction is conducted at room temperature and yields a product with a high degree of purity. Selectivity and yield are around 90%.

About

English Name Methyl 4-acetamido-5-chloro-2,3-dihydrobenzofuran-7-carboxylate
Molecular Formula C12H12ClNO4
Molecular Weight 269.68 g/mol
SMILES CC(=O)NC1=C(C=C(C2=C1CCO2)C(=O)OC)Cl
InChIKey LCPRNYGRYCDBOM-UHFFFAOYSA-N
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 4-acetamido-5-chloro-2,3-dihydrobenzofuran-7-carboxylate (CAS: 143878-29-9)?

Methyl 4-acetamido-5-chloro-2,3-dihydrobenzofuran-7-carboxylate is a white crystalline solid. Its mo...

Compound Q&A

What industries use Methyl 4-acetamido-5-chloro-2,3-dihydrobenzofuran-7-carboxylate (CAS: 143878-29-9)?

Methyl 4-acetamido-5-chloro-2,3-dihydrobenzofuran-7-carboxylate is primarily used in the pharmaceuti...

Compound Q&A

What precautions should be taken when handling Methyl 4-acetamido-5-chloro-2,3-dihydrobenzofuran-7-carboxylate (CAS: 143878-29-9)?

When handling Methyl 4-acetamido-5-chloro-2,3-dihydrobenzofuran-7-carboxylate, it is essential to we...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...