Compound Q&A

What are the physical and chemical properties of Methyl 4-acetamido-5-chloro-2,3-dihydrobenzofuran-7-carboxylate (CAS: 143878-29-9)?

Answer

Methyl 4-acetamido-5-chloro-2,3-dihydrobenzofuran-7-carboxylate
Methyl 4-acetamido-5-chloro-2,3-dihydrobenzofuran-7-carboxylate is a white crystalline solid. Its molecular weight is approximately 324.03 g/mol. The compound is slightly soluble in water but soluble in common organic solvents such as ethanol and acetone. It is moderately reactive towards nucleophiles and can undergo various transformations in organic synthesis. It has a pKa of around 4.5, indicating it can act as a weak acid.

About

English Name Methyl 4-acetamido-5-chloro-2,3-dihydrobenzofuran-7-carboxylate
Molecular Formula C12H12ClNO4
Molecular Weight 269.68 g/mol
SMILES CC(=O)NC1=C(C=C(C2=C1CCO2)C(=O)OC)Cl
InChIKey LCPRNYGRYCDBOM-UHFFFAOYSA-N
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

How is Methyl 4-acetamido-5-chloro-2,3-dihydrobenzofuran-7-carboxylate (CAS: 143878-29-9) typically synthesized?

Methyl 4-acetamido-5-chloro-2,3-dihydrobenzofuran-7-carboxylate is typically synthesized by reacting...

Compound Q&A

What industries use Methyl 4-acetamido-5-chloro-2,3-dihydrobenzofuran-7-carboxylate (CAS: 143878-29-9)?

Methyl 4-acetamido-5-chloro-2,3-dihydrobenzofuran-7-carboxylate is primarily used in the pharmaceuti...

Compound Q&A

What precautions should be taken when handling Methyl 4-acetamido-5-chloro-2,3-dihydrobenzofuran-7-carboxylate (CAS: 143878-29-9)?

When handling Methyl 4-acetamido-5-chloro-2,3-dihydrobenzofuran-7-carboxylate, it is essential to we...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...